1H-Pyrrolo[2,3-b]pyridine,6-methoxy-
Catalog No: FT-0658249
CAS No: 896722-53-5
- Chemical Name: 1H-Pyrrolo[2,3-b]pyridine,6-methoxy-
- Molecular Formula: C8H8N2O
- Molecular Weight: 148.16
- InChI Key: LNEHZEFKSUBWTA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8N2O/c1-11-7-3-2-6-4-5-9-8(6)10-7/h2-5H,1H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 148.162 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 896722-53-5 |
| Bolling_Point: | 284.5±20.0 °C at 760 mmHg |
| Product_Name: | 6-Methoxy-7-azaindole |
| Melting_Point: | 88-89ºC |
| Flash_Point: | 98.3±11.4 °C |
| MF: | C8H8N2O |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 2.23 |
| Flash_Point: | 98.3±11.4 °C |
| Melting_Point: | 88-89ºC |
| FW: | 148.162 |
| PSA: | 37.91000 |
| Exact_Mass: | 148.063660 |
| MF: | C8H8N2O |
| Bolling_Point: | 284.5±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.647 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22;R36 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)